C28H22Br2IrN3 — CID 171745728
1-(3,4-dibromobenzene-6-id-1-yl)-3-ethyl-2H-imidazol-2-ide;iridium(3+);5-phenyl-2-phenylpyridine (PubChem CID 171745728) has the molecular formula C28H22Br2IrN3 and a molecular weight of 752.53 g/mol. Its IUPAC name is 1-(3,4-dibromobenzene-6-id-1-yl)-3-ethyl-2H-imidazol-2-ide;iridium(3+);5-phenyl-2-phenylpyridine.
| Compound Name | 1-(3,4-dibromobenzene-6-id-1-yl)-3-ethyl-2H-imidazol-2-ide;iridium(3+);5-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 171745728 |
| Molecular Formula | C28H22Br2IrN3 |
| Molecular Weight | 752.53 g/mol |
| Exact Mass | 750.98 |
| IUPAC Name | 1-(3,4-dibromobenzene-6-id-1-yl)-3-ethyl-2H-imidazol-2-ide;iridium(3+);5-phenyl-2-phenylpyridine |
| SMILES | CCN1C=CN(c2[c-]cc(Br)c(Br)c2)[CH-]1.[Ir+3].[c-]1ccccc1-c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H12N.C11H10Br2N2.Ir/c1-3-7-14(8-4-1)16-11-12-17(18-13-16)15-9-5-2-6-10-15;1-2-14-5-6-15(8-14)9-3-4-10(12)11(13)7-9;/h1-9,11-13H;4-8H,2H2,1H3;/q-1;-2;+3 |
| InChIKey | GUSIRZPYNBCWMN-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.53 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|