C57H60IrN3 — CID 171404870
5-[3-[[3,5-bis[2-ethyl-2-(6-phenyl-3-pyridinyl)butyl]phenyl]methyl]pentan-3-yl]-2-phenylpyridine;iridium(3+) (PubChem CID 171404870) has the molecular formula C57H60IrN3 and a molecular weight of 979.34 g/mol. Its IUPAC name is 5-[3-[[3,5-bis[2-ethyl-2-(6-phenyl-3-pyridinyl)butyl]phenyl]methyl]pentan-3-yl]-2-phenylpyridine;iridium(3+).
| Compound Name | 5-[3-[[3,5-bis[2-ethyl-2-(6-phenyl-3-pyridinyl)butyl]phenyl]methyl]pentan-3-yl]-2-phenylpyridine;iridium(3+) |
|---|---|
| PubChem CID | 171404870 |
| Molecular Formula | C57H60IrN3 |
| Molecular Weight | 979.34 g/mol |
| Exact Mass | 979.44 |
| IUPAC Name | 5-[3-[[3,5-bis[2-ethyl-2-(6-phenyl-3-pyridinyl)butyl]phenyl]methyl]pentan-3-yl]-2-phenylpyridine;iridium(3+) |
| SMILES | CCC(CC)(Cc1cc(CC(CC)(CC)c2ccc(-c3[c-]cccc3)nc2)cc(CC(CC)(CC)c2ccc(-c3[c-]cccc3)nc2)c1)c1ccc(-c2[c-]cccc2)nc1.[Ir+3] |
| InChI | InChI=1S/C57H60N3.Ir/c1-7-55(8-2,49-28-31-52(58-40-49)46-22-16-13-17-23-46)37-43-34-44(38-56(9-3,10-4)50-29-32-53(59-41-50)47-24-18-14-19-25-47)36-45(35-43)39-57(11-5,12-6)51-30-33-54(60-42-51)48-26-20-15-21-27-48;/h13-22,24,26,28-36,40-42H,7-12,37-39H2,1-6H3;/q-3;+3 |
| InChIKey | SMXGBDFZYCBLGI-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.34 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|