C8H16N2O5 — CID 153453865
(4S)-4-amino-5-[2,2-dihydroxyethyl(methyl)amino]-5-oxopentanoic acid (PubChem CID 153453865) has the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. Its IUPAC name is (4S)-4-amino-5-[2,2-dihydroxyethyl(methyl)amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[2,2-dihydroxyethyl(methyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 153453865 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (4S)-4-amino-5-[2,2-dihydroxyethyl(methyl)amino]-5-oxopentanoic acid |
| SMILES | CN(CC(O)O)C(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C8H16N2O5/c1-10(4-7(13)14)8(15)5(9)2-3-6(11)12/h5,7,13-14H,2-4,9H2,1H3,(H,11,12)/t5-/m0/s1 |
| InChIKey | DDLUTOKZODMFIF-YFKPBYRVSA-N |
| XLogP | -2.05 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|