C7H12FNO3 — CID 153453922
(1S,2S,3S)-6-amino-4-(fluoromethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 153453922) has the molecular formula C7H12FNO3 and a molecular weight of 177.17 g/mol. Its IUPAC name is (1S,2S,3S)-6-amino-4-(fluoromethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3S)-6-amino-4-(fluoromethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 153453922 |
| Molecular Formula | C7H12FNO3 |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (1S,2S,3S)-6-amino-4-(fluoromethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | NC1C=C(CF)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H12FNO3/c8-2-3-1-4(9)6(11)7(12)5(3)10/h1,4-7,10-12H,2,9H2/t4?,5-,6-,7-/m0/s1 |
| InChIKey | XNFHKXWBWOFCJM-KXKONJJBSA-N |
| XLogP | -1.69 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|