C23H48 — CID 153454152
3,9-diethyl-3,9-dimethyl-4-(3-methylpentan-3-yl)undecane (PubChem CID 153454152) has the molecular formula C23H48 and a molecular weight of 324.64 g/mol. Its IUPAC name is 3,9-diethyl-3,9-dimethyl-4-(3-methylpentan-3-yl)undecane.
| Compound Name | 3,9-diethyl-3,9-dimethyl-4-(3-methylpentan-3-yl)undecane |
|---|---|
| PubChem CID | 153454152 |
| Molecular Formula | C23H48 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.38 |
| IUPAC Name | 3,9-diethyl-3,9-dimethyl-4-(3-methylpentan-3-yl)undecane |
| SMILES | CCC(C)(CC)CCCCC(C(C)(CC)CC)C(C)(CC)CC |
| InChI | InChI=1S/C23H48/c1-10-21(7,11-2)19-17-16-18-20(22(8,12-3)13-4)23(9,14-5)15-6/h20H,10-19H2,1-9H3 |
| InChIKey | KZDMJMNKCCBLOF-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|