About 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane
3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane (PubChem CID 153454160) has the molecular formula C21H44
and a molecular weight of 296.58 g/mol. Its IUPAC name is 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane.
Molecular Properties
| Compound Name | 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane |
| PubChem CID | 153454160 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane |
| SMILES | CCCC(C)(CC)C(CC(C)(CC)CC)C(C)(CC)CC |
| InChI | InChI=1S/C21H44/c1-10-16-21(9,15-6)18(20(8,13-4)14-5)17-19(7,11-2)12-3/h18H,10-17H2,1-9H3 |
| InChIKey | BLRJQEUYZYSHBL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane?
The IUPAC name of 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane (CID 153454160) is 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane.
What is the SMILES notation for 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane?
The canonical SMILES for 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane is CCCC(C)(CC)C(CC(C)(CC)CC)C(C)(CC)CC.
What is the InChIKey of 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane?
The InChIKey is BLRJQEUYZYSHBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44/c1-10-16-21(9,15-6)18(20(8,13-4)14-5)17-19(7,11-2)12-3/h18H,10-17H2,1-9H3.
What are the key properties of 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane?
3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane has a molecular weight of 296.58 g/mol, XLogP of 7.86, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diethyl-3,6-dimethyl-5-(3-methylpentan-3-yl)nonane is sourced from PubChem (CID 153454160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).