C55H68F2N2O7 — CID 153454808
[7-[1,3-bis[[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate (PubChem CID 153454808) has the molecular formula C55H68F2N2O7 and a molecular weight of 907.15 g/mol. Its IUPAC name is [7-[1,3-bis[[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate.
| Compound Name | [7-[1,3-bis[[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 153454808 |
| Molecular Formula | C55H68F2N2O7 |
| Molecular Weight | 907.15 g/mol |
| Exact Mass | 906.50 |
| IUPAC Name | [7-[1,3-bis[[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCOC(COc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(C)c2c1)COc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(C)c2c1 |
| InChI | InChI=1S/C55H68F2N2O7/c1-8-11-13-17-39-19-25-46(52(31-39)61-6)50-33-41-21-23-43(35-48(41)58(50)4)65-37-45(63-29-15-27-55(56,57)28-16-30-64-54(60)10-3)38-66-44-24-22-42-34-51(59(5)49(42)36-44)47-26-20-40(18-14-12-9-2)32-53(47)62-7/h10,19-26,31-36,45H,3,8-9,11-18,27-30,37-38H2,1-2,4-7H3 |
| InChIKey | ISOTXTMIEPDFBC-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 82.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.15 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|