C71H44IrN5 — CID 153457930
5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-triphenylen-2-ylbenzene-6-id-1-yl)pyridine;iridium(3+) (PubChem CID 153457930) has the molecular formula C71H44IrN5 and a molecular weight of 1159.38 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-triphenylen-2-ylbenzene-6-id-1-yl)pyridine;iridium(3+).
| Compound Name | 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-triphenylen-2-ylbenzene-6-id-1-yl)pyridine;iridium(3+) |
|---|---|
| PubChem CID | 153457930 |
| Molecular Formula | C71H44IrN5 |
| Molecular Weight | 1159.38 g/mol |
| Exact Mass | 1159.32 |
| IUPAC Name | 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-triphenylen-2-ylbenzene-6-id-1-yl)pyridine;iridium(3+) |
| SMILES | [Ir+3].[c-]1ccc(-c2ccc3c4ccccc4c4ccccc4c3c2)cc1-c1ccc(-c2ccccc2-c2cc(-c3ccccc3-c3cnn(-c4[c-]cccc4)c3)cc(-c3ccccc3-c3cnn(-c4[c-]cccc4)c3)c2)cn1 |
| InChI | InChI=1S/C71H44N5.Ir/c1-3-20-57(21-4-1)75-46-55(44-73-75)63-28-11-9-26-61(63)53-39-52(40-54(41-53)62-27-10-12-29-64(62)56-45-74-76(47-56)58-22-5-2-6-23-58)60-25-8-7-24-59(60)51-35-37-71(72-43-51)50-19-17-18-48(38-50)49-34-36-69-67-32-14-13-30-65(67)66-31-15-16-33-68(66)70(69)42-49;/h1-18,20,22,24-47H;/q-3;+3 |
| InChIKey | CMCVXVQTJMQAER-UHFFFAOYSA-N |
| XLogP | 17.65 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1159.38 |
| LogP ≤ 5 | 17.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|