C63H40IrN7 — CID 153458523
5-[2-[3,5-bis[2-(2-phenyltriazol-4-yl)phenyl]phenyl]phenyl]-2-[3-(4-phenylphenyl)benzene-6-id-1-yl]pyridine;iridium(3+) (PubChem CID 153458523) has the molecular formula C63H40IrN7 and a molecular weight of 1087.28 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(2-phenyltriazol-4-yl)phenyl]phenyl]phenyl]-2-[3-(4-phenylphenyl)benzene-6-id-1-yl]pyridine;iridium(3+).
| Compound Name | 5-[2-[3,5-bis[2-(2-phenyltriazol-4-yl)phenyl]phenyl]phenyl]-2-[3-(4-phenylphenyl)benzene-6-id-1-yl]pyridine;iridium(3+) |
|---|---|
| PubChem CID | 153458523 |
| Molecular Formula | C63H40IrN7 |
| Molecular Weight | 1087.28 g/mol |
| Exact Mass | 1087.30 |
| IUPAC Name | 5-[2-[3,5-bis[2-(2-phenyltriazol-4-yl)phenyl]phenyl]phenyl]-2-[3-(4-phenylphenyl)benzene-6-id-1-yl]pyridine;iridium(3+) |
| SMILES | [Ir+3].[c-]1ccc(-c2ccc(-c3ccccc3)cc2)cc1-c1ccc(-c2ccccc2-c2cc(-c3ccccc3-c3cnn(-c4[c-]cccc4)n3)cc(-c3ccccc3-c3cnn(-c4[c-]cccc4)n3)c2)cn1 |
| InChI | InChI=1S/C63H40N7.Ir/c1-4-17-44(18-5-1)45-31-33-46(34-32-45)47-19-16-20-48(37-47)61-36-35-49(41-64-61)55-25-10-11-26-56(55)50-38-51(57-27-12-14-29-59(57)62-42-65-69(67-62)53-21-6-2-7-22-53)40-52(39-50)58-28-13-15-30-60(58)63-43-66-70(68-63)54-23-8-3-9-24-54;/h1-19,21,23,25-43H;/q-3;+3 |
| InChIKey | QMMLFTUXEWNPRN-UHFFFAOYSA-N |
| XLogP | 14.64 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.28 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|