C50H33N5O — CID 153460045
10-[5-(3,4-diphenylphenyl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]phenoxazine (PubChem CID 153460045) has the molecular formula C50H33N5O and a molecular weight of 719.85 g/mol. Its IUPAC name is 10-[5-(3,4-diphenylphenyl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]phenoxazine.
| Compound Name | 10-[5-(3,4-diphenylphenyl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]phenoxazine |
|---|---|
| PubChem CID | 153460045 |
| Molecular Formula | C50H33N5O |
| Molecular Weight | 719.85 g/mol |
| Exact Mass | 719.27 |
| IUPAC Name | 10-[5-(3,4-diphenylphenyl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]phenoxazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccc(-c5ccccc5)c(-c5ccccc5)c4)cnc3N3c4ccccc4Oc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C50H33N5O/c1-5-17-34(18-6-1)40-30-29-38(31-41(40)35-19-7-2-8-20-35)39-32-42(49-53-47(36-21-9-3-10-22-36)52-48(54-49)37-23-11-4-12-24-37)50(51-33-39)55-43-25-13-15-27-45(43)56-46-28-16-14-26-44(46)55/h1-33H |
| InChIKey | MAHRHZYLCDCLEV-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.85 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |