C47H36N4Si — CID 153460425
5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylphenyl)phenyl]-10,10-dimethylbenzo[b][1,4]benzazasiline (PubChem CID 153460425) has the molecular formula C47H36N4Si and a molecular weight of 684.92 g/mol. Its IUPAC name is 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylphenyl)phenyl]-10,10-dimethylbenzo[b][1,4]benzazasiline.
| Compound Name | 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylphenyl)phenyl]-10,10-dimethylbenzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 153460425 |
| Molecular Formula | C47H36N4Si |
| Molecular Weight | 684.92 g/mol |
| Exact Mass | 684.27 |
| IUPAC Name | 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylphenyl)phenyl]-10,10-dimethylbenzo[b][1,4]benzazasiline |
| SMILES | C[Si]1(C)c2ccccc2N(c2ccc(-c3ccccc3-c3ccccc3)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c2ccccc21 |
| InChI | InChI=1S/C47H36N4Si/c1-52(2)43-28-16-14-26-41(43)51(42-27-15-17-29-44(42)52)40-31-30-36(38-25-13-12-24-37(38)33-18-6-3-7-19-33)32-39(40)47-49-45(34-20-8-4-9-21-34)48-46(50-47)35-22-10-5-11-23-35/h3-32H,1-2H3 |
| InChIKey | YYHJNWXURNBBJH-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.92 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|