C40H26N2S — CID 153462812
9-[2-(7,7-dimethylfluoreno[4,3-b][1]benzothiol-1-yl)-3-isocyanophenyl]carbazole (PubChem CID 153462812) has the molecular formula C40H26N2S and a molecular weight of 566.73 g/mol. Its IUPAC name is 9-[2-(7,7-dimethylfluoreno[4,3-b][1]benzothiol-1-yl)-3-isocyanophenyl]carbazole.
| Compound Name | 9-[2-(7,7-dimethylfluoreno[4,3-b][1]benzothiol-1-yl)-3-isocyanophenyl]carbazole |
|---|---|
| PubChem CID | 153462812 |
| Molecular Formula | C40H26N2S |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 9-[2-(7,7-dimethylfluoreno[4,3-b][1]benzothiol-1-yl)-3-isocyanophenyl]carbazole |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccccc3c3ccccc32)c1-c1cccc2c1sc1c3c(ccc12)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C40H26N2S/c1-40(2)30-17-7-4-14-28(30)36-31(40)23-22-27-26-15-10-16-29(38(26)43-39(27)36)37-32(41-3)18-11-21-35(37)42-33-19-8-5-12-24(33)25-13-6-9-20-34(25)42/h4-23H,1-2H3 |
| InChIKey | HSUPHEAGMLZMJJ-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 9.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|