C41H25N3O — CID 153462903
9-[2-(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)-3-isocyanophenyl]carbazole-3-carbonitrile (PubChem CID 153462903) has the molecular formula C41H25N3O and a molecular weight of 575.67 g/mol. Its IUPAC name is 9-[2-(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)-3-isocyanophenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[2-(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)-3-isocyanophenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 153462903 |
| Molecular Formula | C41H25N3O |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 9-[2-(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)-3-isocyanophenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccccc3c3cc(C#N)ccc32)c1-c1cccc2c1oc1c3c(ccc12)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C41H25N3O/c1-41(2)31-14-6-4-11-28(31)37-32(41)20-19-27-26-12-8-13-29(39(26)45-40(27)37)38-33(43-3)15-9-17-36(38)44-34-16-7-5-10-25(34)30-22-24(23-42)18-21-35(30)44/h4-22H,1-2H3 |
| InChIKey | PTFXBAAVEXHUTM-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 46.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|