C17H17NSe — CID 153463463
6-(3-methyl-5-propan-2-ylphenyl)selenopheno[3,2-c]pyridine (PubChem CID 153463463) has the molecular formula C17H17NSe and a molecular weight of 314.29 g/mol. Its IUPAC name is 6-(3-methyl-5-propan-2-ylphenyl)selenopheno[3,2-c]pyridine.
| Compound Name | 6-(3-methyl-5-propan-2-ylphenyl)selenopheno[3,2-c]pyridine |
|---|---|
| PubChem CID | 153463463 |
| Molecular Formula | C17H17NSe |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 6-(3-methyl-5-propan-2-ylphenyl)selenopheno[3,2-c]pyridine |
| SMILES | Cc1cc(-c2cc3[se]ccc3cn2)cc(C(C)C)c1 |
| InChI | InChI=1S/C17H17NSe/c1-11(2)14-6-12(3)7-15(8-14)16-9-17-13(10-18-16)4-5-19-17/h4-11H,1-3H3 |
| InChIKey | NQTDWNCONNUMGB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|