C18H19NSe — CID 153463540
5-(3-butan-2-yl-5-methylphenyl)selenopheno[3,2-b]pyridine (PubChem CID 153463540) has the molecular formula C18H19NSe and a molecular weight of 328.32 g/mol. Its IUPAC name is 5-(3-butan-2-yl-5-methylphenyl)selenopheno[3,2-b]pyridine.
| Compound Name | 5-(3-butan-2-yl-5-methylphenyl)selenopheno[3,2-b]pyridine |
|---|---|
| PubChem CID | 153463540 |
| Molecular Formula | C18H19NSe |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-(3-butan-2-yl-5-methylphenyl)selenopheno[3,2-b]pyridine |
| SMILES | CCC(C)c1cc(C)cc(-c2ccc3[se]ccc3n2)c1 |
| InChI | InChI=1S/C18H19NSe/c1-4-13(3)14-9-12(2)10-15(11-14)16-5-6-18-17(19-16)7-8-20-18/h5-11,13H,4H2,1-3H3 |
| InChIKey | NRLZDMSBMJUWPU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|