C19H21NSe — CID 153463280
6-(3-methyl-5-pentan-3-ylphenyl)selenopheno[3,2-c]pyridine (PubChem CID 153463280) has the molecular formula C19H21NSe and a molecular weight of 342.34 g/mol. Its IUPAC name is 6-(3-methyl-5-pentan-3-ylphenyl)selenopheno[3,2-c]pyridine.
| Compound Name | 6-(3-methyl-5-pentan-3-ylphenyl)selenopheno[3,2-c]pyridine |
|---|---|
| PubChem CID | 153463280 |
| Molecular Formula | C19H21NSe |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 6-(3-methyl-5-pentan-3-ylphenyl)selenopheno[3,2-c]pyridine |
| SMILES | CCC(CC)c1cc(C)cc(-c2cc3[se]ccc3cn2)c1 |
| InChI | InChI=1S/C19H21NSe/c1-4-14(5-2)16-8-13(3)9-17(10-16)18-11-19-15(12-20-18)6-7-21-19/h6-12,14H,4-5H2,1-3H3 |
| InChIKey | RAJQFUXWYDGCRH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|