C25H16FI2O3S+ — CID 153464230
(4-fluorophenyl)-[4-(2-hydroxy-3,6-diiodobenzoyl)oxyphenyl]-phenylsulfanium (PubChem CID 153464230) has the molecular formula C25H16FI2O3S+ and a molecular weight of 669.27 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(2-hydroxy-3,6-diiodobenzoyl)oxyphenyl]-phenylsulfanium.
| Compound Name | (4-fluorophenyl)-[4-(2-hydroxy-3,6-diiodobenzoyl)oxyphenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 153464230 |
| Molecular Formula | C25H16FI2O3S+ |
| Molecular Weight | 669.27 g/mol |
| Exact Mass | 668.89 |
| IUPAC Name | (4-fluorophenyl)-[4-(2-hydroxy-3,6-diiodobenzoyl)oxyphenyl]-phenylsulfanium |
| SMILES | O=C(Oc1ccc([S+](c2ccccc2)c2ccc(F)cc2)cc1)c1c(I)ccc(I)c1O |
| InChI | InChI=1S/C25H15FI2O3S/c26-16-6-10-19(11-7-16)32(18-4-2-1-3-5-18)20-12-8-17(9-13-20)31-25(30)23-21(27)14-15-22(28)24(23)29/h1-15H/p+1 |
| InChIKey | HQTVXLLJOGHKLM-UHFFFAOYSA-O |
| XLogP | 7.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.27 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|