C25H21F2N2O+ — CID 153464376
4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-3-methyl-7-propan-2-ylquinazolin-3-ium (PubChem CID 153464376) has the molecular formula C25H21F2N2O+ and a molecular weight of 403.45 g/mol. Its IUPAC name is 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-3-methyl-7-propan-2-ylquinazolin-3-ium.
| Compound Name | 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-3-methyl-7-propan-2-ylquinazolin-3-ium |
|---|---|
| PubChem CID | 153464376 |
| Molecular Formula | C25H21F2N2O+ |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-3-methyl-7-propan-2-ylquinazolin-3-ium |
| SMILES | Cc1ccc2c(oc3cc(F)cc(F)c32)c1-c1c2ccc(C(C)C)cc2nc[n+]1C |
| InChI | InChI=1S/C25H21F2N2O/c1-13(2)15-6-8-17-20(9-15)28-12-29(4)24(17)22-14(3)5-7-18-23-19(27)10-16(26)11-21(23)30-25(18)22/h5-13H,1-4H3/q+1 |
| InChIKey | MGLWVNUBXYBQSY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|