C28H21FN3O+ — CID 153464410
2-fluoro-7-methyl-6-[1-methyl-3-(2-phenylphenyl)imidazol-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 153464410) has the molecular formula C28H21FN3O+ and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-fluoro-7-methyl-6-[1-methyl-3-(2-phenylphenyl)imidazol-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-fluoro-7-methyl-6-[1-methyl-3-(2-phenylphenyl)imidazol-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153464410 |
| Molecular Formula | C28H21FN3O+ |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-fluoro-7-methyl-6-[1-methyl-3-(2-phenylphenyl)imidazol-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc2oc3nc(F)ccc3c2cc1-c1n(-c2ccccc2-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C28H21FN3O/c1-18-16-25-23(21-12-13-26(29)30-27(21)33-25)17-22(18)28-31(2)14-15-32(28)24-11-7-6-10-20(24)19-8-4-3-5-9-19/h3-17H,1-2H3/q+1 |
| InChIKey | HHZMPEBETAHHDA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|