C74H110O4S2 — CID 153467099
butyl 3-[8-[9-[8-(3-butoxy-3-oxopropyl)sulfanyloctyl]-2-methyl-7-(7-methyl-9,9-dioctylfluoren-2-yl)fluoren-9-yl]octylsulfanyl]propanoate (PubChem CID 153467099) has the molecular formula C74H110O4S2 and a molecular weight of 1127.82 g/mol. Its IUPAC name is butyl 3-[8-[9-[8-(3-butoxy-3-oxopropyl)sulfanyloctyl]-2-methyl-7-(7-methyl-9,9-dioctylfluoren-2-yl)fluoren-9-yl]octylsulfanyl]propanoate.
| Compound Name | butyl 3-[8-[9-[8-(3-butoxy-3-oxopropyl)sulfanyloctyl]-2-methyl-7-(7-methyl-9,9-dioctylfluoren-2-yl)fluoren-9-yl]octylsulfanyl]propanoate |
|---|---|
| PubChem CID | 153467099 |
| Molecular Formula | C74H110O4S2 |
| Molecular Weight | 1127.82 g/mol |
| Exact Mass | 1126.78 |
| IUPAC Name | butyl 3-[8-[9-[8-(3-butoxy-3-oxopropyl)sulfanyloctyl]-2-methyl-7-(7-methyl-9,9-dioctylfluoren-2-yl)fluoren-9-yl]octylsulfanyl]propanoate |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc4c(c3)C(CCCCCCCCSCCC(=O)OCCCC)(CCCCCCCCSCCC(=O)OCCCC)c3cc(C)ccc3-4)cc21 |
| InChI | InChI=1S/C74H110O4S2/c1-7-11-15-17-23-29-45-73(46-30-24-18-16-12-8-2)67-55-59(5)35-39-63(67)65-41-37-61(57-69(65)73)62-38-42-66-64-40-36-60(6)56-68(64)74(70(66)58-62,47-31-25-19-21-27-33-51-79-53-43-71(75)77-49-13-9-3)48-32-26-20-22-28-34-52-80-54-44-72(76)78-50-14-10-4/h35-42,55-58H,7-34,43-54H2,1-6H3 |
| InChIKey | NBYUGGDWESGWSR-UHFFFAOYSA-N |
| XLogP | 22.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1127.82 |
| LogP ≤ 5 | 22.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|