C33H33N4O2S+ — CID 153467612
(4Z)-4-[(1-benzyl-3-ethylbenzimidazol-1-ium-2-yl)methylidene]-2-[(Z)-[1-ethyl-3-(2-hydroxyethyl)benzimidazol-2-ylidene]methyl]-3-sulfanylcyclobut-2-en-1-one (PubChem CID 153467612) has the molecular formula C33H33N4O2S+ and a molecular weight of 549.72 g/mol. Its IUPAC name is (4Z)-4-[(1-benzyl-3-ethylbenzimidazol-1-ium-2-yl)methylidene]-2-[(Z)-[1-ethyl-3-(2-hydroxyethyl)benzimidazol-2-ylidene]methyl]-3-sulfanylcyclobut-2-en-1-one.
| Compound Name | (4Z)-4-[(1-benzyl-3-ethylbenzimidazol-1-ium-2-yl)methylidene]-2-[(Z)-[1-ethyl-3-(2-hydroxyethyl)benzimidazol-2-ylidene]methyl]-3-sulfanylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 153467612 |
| Molecular Formula | C33H33N4O2S+ |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | (4Z)-4-[(1-benzyl-3-ethylbenzimidazol-1-ium-2-yl)methylidene]-2-[(Z)-[1-ethyl-3-(2-hydroxyethyl)benzimidazol-2-ylidene]methyl]-3-sulfanylcyclobut-2-en-1-one |
| SMILES | CCN1/C(=C/C2=C(S)/C(=C\c3n(CC)c4ccccc4[n+]3Cc3ccccc3)C2=O)N(CCO)c2ccccc21 |
| InChI | InChI=1S/C33H32N4O2S/c1-3-34-26-14-8-10-16-28(26)36(18-19-38)30(34)20-24-32(39)25(33(24)40)21-31-35(4-2)27-15-9-11-17-29(27)37(31)22-23-12-6-5-7-13-23/h5-17,20-21,38H,3-4,18-19,22H2,1-2H3/p+1 |
| InChIKey | OPJRFXNVLVBBSE-UHFFFAOYSA-O |
| XLogP | 5.33 |
| TPSA | 52.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|