C20H17N3O — CID 153469840
6-[(5-methyl-2-pyridinyl)methoxy]-2-pyridin-3-yl-3H-indole (PubChem CID 153469840) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 6-[(5-methyl-2-pyridinyl)methoxy]-2-pyridin-3-yl-3H-indole.
| Compound Name | 6-[(5-methyl-2-pyridinyl)methoxy]-2-pyridin-3-yl-3H-indole |
|---|---|
| PubChem CID | 153469840 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 6-[(5-methyl-2-pyridinyl)methoxy]-2-pyridin-3-yl-3H-indole |
| SMILES | Cc1ccc(COc2ccc3c(c2)N=C(c2cccnc2)C3)nc1 |
| InChI | InChI=1S/C20H17N3O/c1-14-4-6-17(22-11-14)13-24-18-7-5-15-9-19(23-20(15)10-18)16-3-2-8-21-12-16/h2-8,10-12H,9,13H2,1H3 |
| InChIKey | UGSVFMFZZVHMGZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |