C18H29ClN4O3 — CID 153473191
6-[(4-chlorocyclohexyl)methyl]-7,10-dioxo-9-propan-2-yl-2,6,9-triazaspiro[4.5]decane-2-carboxamide (PubChem CID 153473191) has the molecular formula C18H29ClN4O3 and a molecular weight of 384.91 g/mol. Its IUPAC name is 6-[(4-chlorocyclohexyl)methyl]-7,10-dioxo-9-propan-2-yl-2,6,9-triazaspiro[4.5]decane-2-carboxamide.
| Compound Name | 6-[(4-chlorocyclohexyl)methyl]-7,10-dioxo-9-propan-2-yl-2,6,9-triazaspiro[4.5]decane-2-carboxamide |
|---|---|
| PubChem CID | 153473191 |
| Molecular Formula | C18H29ClN4O3 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 6-[(4-chlorocyclohexyl)methyl]-7,10-dioxo-9-propan-2-yl-2,6,9-triazaspiro[4.5]decane-2-carboxamide |
| SMILES | CC(C)N1CC(=O)N(CC2CCC(Cl)CC2)C2(CCN(C(N)=O)C2)C1=O |
| InChI | InChI=1S/C18H29ClN4O3/c1-12(2)22-10-15(24)23(9-13-3-5-14(19)6-4-13)18(16(22)25)7-8-21(11-18)17(20)26/h12-14H,3-11H2,1-2H3,(H2,20,26) |
| InChIKey | BOKDAZCJSPQGGD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|