C21H32ClN3O2 — CID 153473247
3-[[2-(4-chlorocyclohexyl)-3,6-dioxo-4-propan-2-ylpiperazin-1-yl]methyl]cyclohexane-1-carbonitrile (PubChem CID 153473247) has the molecular formula C21H32ClN3O2 and a molecular weight of 393.96 g/mol. Its IUPAC name is 3-[[2-(4-chlorocyclohexyl)-3,6-dioxo-4-propan-2-ylpiperazin-1-yl]methyl]cyclohexane-1-carbonitrile.
| Compound Name | 3-[[2-(4-chlorocyclohexyl)-3,6-dioxo-4-propan-2-ylpiperazin-1-yl]methyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 153473247 |
| Molecular Formula | C21H32ClN3O2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-[[2-(4-chlorocyclohexyl)-3,6-dioxo-4-propan-2-ylpiperazin-1-yl]methyl]cyclohexane-1-carbonitrile |
| SMILES | CC(C)N1CC(=O)N(CC2CCCC(C#N)C2)C(C2CCC(Cl)CC2)C1=O |
| InChI | InChI=1S/C21H32ClN3O2/c1-14(2)24-13-19(26)25(12-16-5-3-4-15(10-16)11-23)20(21(24)27)17-6-8-18(22)9-7-17/h14-18,20H,3-10,12-13H2,1-2H3 |
| InChIKey | QWNQTCMMMXKWBG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|