C20H31ClFN3O4 — CID 153473188
(3S)-4-[(4-chlorocyclohexyl)methyl]-1-(3-fluoro-5-methoxypiperidin-2-yl)-3-(oxetan-3-yl)piperazine-2,5-dione (PubChem CID 153473188) has the molecular formula C20H31ClFN3O4 and a molecular weight of 431.94 g/mol. Its IUPAC name is (3S)-4-[(4-chlorocyclohexyl)methyl]-1-(3-fluoro-5-methoxypiperidin-2-yl)-3-(oxetan-3-yl)piperazine-2,5-dione.
| Compound Name | (3S)-4-[(4-chlorocyclohexyl)methyl]-1-(3-fluoro-5-methoxypiperidin-2-yl)-3-(oxetan-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 153473188 |
| Molecular Formula | C20H31ClFN3O4 |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (3S)-4-[(4-chlorocyclohexyl)methyl]-1-(3-fluoro-5-methoxypiperidin-2-yl)-3-(oxetan-3-yl)piperazine-2,5-dione |
| SMILES | COC1CNC(N2CC(=O)N(CC3CCC(Cl)CC3)[C@@H](C3COC3)C2=O)C(F)C1 |
| InChI | InChI=1S/C20H31ClFN3O4/c1-28-15-6-16(22)19(23-7-15)25-9-17(26)24(8-12-2-4-14(21)5-3-12)18(20(25)27)13-10-29-11-13/h12-16,18-19,23H,2-11H2,1H3/t12?,14?,15?,16?,18-,19?/m0/s1 |
| InChIKey | OYWDNTGGOIQXCS-WNXITQJLSA-N |
| XLogP | 1.14 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|