C20H31ClFN3O3 — CID 153473196
1-(5-chloro-3-methylpiperidin-2-yl)-4-[(4-fluorocyclohexyl)methyl]-3-(oxetan-3-yl)piperazine-2,5-dione (PubChem CID 153473196) has the molecular formula C20H31ClFN3O3 and a molecular weight of 415.94 g/mol. Its IUPAC name is 1-(5-chloro-3-methylpiperidin-2-yl)-4-[(4-fluorocyclohexyl)methyl]-3-(oxetan-3-yl)piperazine-2,5-dione.
| Compound Name | 1-(5-chloro-3-methylpiperidin-2-yl)-4-[(4-fluorocyclohexyl)methyl]-3-(oxetan-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 153473196 |
| Molecular Formula | C20H31ClFN3O3 |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-(5-chloro-3-methylpiperidin-2-yl)-4-[(4-fluorocyclohexyl)methyl]-3-(oxetan-3-yl)piperazine-2,5-dione |
| SMILES | CC1CC(Cl)CNC1N1CC(=O)N(CC2CCC(F)CC2)C(C2COC2)C1=O |
| InChI | InChI=1S/C20H31ClFN3O3/c1-12-6-15(21)7-23-19(12)25-9-17(26)24(8-13-2-4-16(22)5-3-13)18(20(25)27)14-10-28-11-14/h12-16,18-19,23H,2-11H2,1H3 |
| InChIKey | XLXXSSQTLZKFFQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|