C23H36ClN3O3 — CID 153473287
6-[(4-chlorocyclohexyl)methyl]-2-cyclohexyl-9-propan-2-yl-2,6,9-triazaspiro[4.5]decane-3,7,10-trione (PubChem CID 153473287) has the molecular formula C23H36ClN3O3 and a molecular weight of 438.01 g/mol. Its IUPAC name is 6-[(4-chlorocyclohexyl)methyl]-2-cyclohexyl-9-propan-2-yl-2,6,9-triazaspiro[4.5]decane-3,7,10-trione.
| Compound Name | 6-[(4-chlorocyclohexyl)methyl]-2-cyclohexyl-9-propan-2-yl-2,6,9-triazaspiro[4.5]decane-3,7,10-trione |
|---|---|
| PubChem CID | 153473287 |
| Molecular Formula | C23H36ClN3O3 |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 6-[(4-chlorocyclohexyl)methyl]-2-cyclohexyl-9-propan-2-yl-2,6,9-triazaspiro[4.5]decane-3,7,10-trione |
| SMILES | CC(C)N1CC(=O)N(CC2CCC(Cl)CC2)C2(CC(=O)N(C3CCCCC3)C2)C1=O |
| InChI | InChI=1S/C23H36ClN3O3/c1-16(2)25-14-21(29)27(13-17-8-10-18(24)11-9-17)23(22(25)30)12-20(28)26(15-23)19-6-4-3-5-7-19/h16-19H,3-15H2,1-2H3 |
| InChIKey | ADDYKASKNAHPGA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|