C26H14F6N6Pt — CID 153474933
platinum(2+);bis(1-[3-(trifluoromethyl)pyrazol-1-id-5-yl]isoquinoline) (PubChem CID 153474933) has the molecular formula C26H14F6N6Pt and a molecular weight of 719.51 g/mol. Its IUPAC name is platinum(2+);bis(1-[3-(trifluoromethyl)pyrazol-1-id-5-yl]isoquinoline).
| Compound Name | platinum(2+);bis(1-[3-(trifluoromethyl)pyrazol-1-id-5-yl]isoquinoline) |
|---|---|
| PubChem CID | 153474933 |
| Molecular Formula | C26H14F6N6Pt |
| Molecular Weight | 719.51 g/mol |
| Exact Mass | 719.08 |
| IUPAC Name | platinum(2+);bis(1-[3-(trifluoromethyl)pyrazol-1-id-5-yl]isoquinoline) |
| SMILES | FC(F)(F)c1cc(-c2nccc3ccccc23)[n-]n1.FC(F)(F)c1cc(-c2nccc3ccccc23)[n-]n1.[Pt+2] |
| InChI | InChI=1S/2C13H7F3N3.Pt/c2*14-13(15,16)11-7-10(18-19-11)12-9-4-2-1-3-8(9)5-6-17-12;/h2*1-7H;/q2*-1;+2 |
| InChIKey | WRNRKQQPVXRPPY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |