C16H28NO6S- — CID 153475400
3-morpholin-4-yl-2-[(E)-non-2-enoyl]oxypropane-1-sulfonate (PubChem CID 153475400) has the molecular formula C16H28NO6S- and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-morpholin-4-yl-2-[(E)-non-2-enoyl]oxypropane-1-sulfonate.
| Compound Name | 3-morpholin-4-yl-2-[(E)-non-2-enoyl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 153475400 |
| Molecular Formula | C16H28NO6S- |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-morpholin-4-yl-2-[(E)-non-2-enoyl]oxypropane-1-sulfonate |
| SMILES | CCCCCC/C=C/C(=O)OC(CN1CCOCC1)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H29NO6S/c1-2-3-4-5-6-7-8-16(18)23-15(14-24(19,20)21)13-17-9-11-22-12-10-17/h7-8,15H,2-6,9-14H2,1H3,(H,19,20,21)/p-1/b8-7+ |
| InChIKey | HTOFXCUJNBHANK-BQYQJAHWSA-M |
| XLogP | 1.30 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|