C10H16NO6S- — CID 153475395
3-morpholin-4-yl-2-prop-2-enoyloxypropane-1-sulfonate (PubChem CID 153475395) has the molecular formula C10H16NO6S- and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-morpholin-4-yl-2-prop-2-enoyloxypropane-1-sulfonate.
| Compound Name | 3-morpholin-4-yl-2-prop-2-enoyloxypropane-1-sulfonate |
|---|---|
| PubChem CID | 153475395 |
| Molecular Formula | C10H16NO6S- |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-morpholin-4-yl-2-prop-2-enoyloxypropane-1-sulfonate |
| SMILES | C=CC(=O)OC(CN1CCOCC1)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H17NO6S/c1-2-10(12)17-9(8-18(13,14)15)7-11-3-5-16-6-4-11/h2,9H,1,3-8H2,(H,13,14,15)/p-1 |
| InChIKey | LUIAOLKLOXJUKI-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|