C11H22NO7S- — CID 153475375
2-(2-methoxyethoxymethoxy)-3-morpholin-4-ylpropane-1-sulfonate (PubChem CID 153475375) has the molecular formula C11H22NO7S- and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-(2-methoxyethoxymethoxy)-3-morpholin-4-ylpropane-1-sulfonate.
| Compound Name | 2-(2-methoxyethoxymethoxy)-3-morpholin-4-ylpropane-1-sulfonate |
|---|---|
| PubChem CID | 153475375 |
| Molecular Formula | C11H22NO7S- |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-(2-methoxyethoxymethoxy)-3-morpholin-4-ylpropane-1-sulfonate |
| SMILES | COCCOCOC(CN1CCOCC1)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H23NO7S/c1-16-6-7-18-10-19-11(9-20(13,14)15)8-12-2-4-17-5-3-12/h11H,2-10H2,1H3,(H,13,14,15)/p-1 |
| InChIKey | QSCAGLDAPNSIJO-UHFFFAOYSA-M |
| XLogP | -1.13 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|