C25H28IrN2O2-2 — CID 153483653
2,6-di(butan-2-yl)-3-phenyl-4H-pyridin-4-ide;iridium;pyridine-2-carboxylic acid (PubChem CID 153483653) has the molecular formula C25H28IrN2O2-2 and a molecular weight of 580.73 g/mol. Its IUPAC name is 2,6-di(butan-2-yl)-3-phenyl-4H-pyridin-4-ide;iridium;pyridine-2-carboxylic acid.
| Compound Name | 2,6-di(butan-2-yl)-3-phenyl-4H-pyridin-4-ide;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 153483653 |
| Molecular Formula | C25H28IrN2O2-2 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 2,6-di(butan-2-yl)-3-phenyl-4H-pyridin-4-ide;iridium;pyridine-2-carboxylic acid |
| SMILES | CCC(C)c1c[c-]c(-c2[c-]cccc2)c(C(C)CC)n1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C19H23N.C6H5NO2.Ir/c1-5-14(3)18-13-12-17(16-10-8-7-9-11-16)19(20-18)15(4)6-2;8-6(9)5-3-1-2-4-7-5;/h7-10,13-15H,5-6H2,1-4H3;1-4H,(H,8,9);/q-2;; |
| InChIKey | DEXCDZFEQXVGNA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|