C40H47F3IrNO2- — CID 153484554
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4,4-dimethylcyclohexyl)-5,7-dimethylquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one (PubChem CID 153484554) has the molecular formula C40H47F3IrNO2- and a molecular weight of 823.03 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4,4-dimethylcyclohexyl)-5,7-dimethylquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4,4-dimethylcyclohexyl)-5,7-dimethylquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one |
|---|---|
| PubChem CID | 153484554 |
| Molecular Formula | C40H47F3IrNO2- |
| Molecular Weight | 823.03 g/mol |
| Exact Mass | 823.32 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4,4-dimethylcyclohexyl)-5,7-dimethylquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one |
| SMILES | CC(C)/C(O)=C/C(=O)C(F)(F)F.Cc1cc(C)c2c(C3CCC(C)(C)CC3)cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nc2c1.[Ir] |
| InChI | InChI=1S/C33H38N.C7H9F3O2.Ir/c1-21-16-22(2)31-27(23-12-14-33(6,7)15-13-23)20-29(34-30(31)17-21)25-18-24-10-8-9-11-26(24)28(19-25)32(3,4)5;1-4(2)5(11)3-6(12)7(8,9)10;/h8-11,16-17,19-20,23H,12-15H2,1-7H3;3-4,11H,1-2H3;/q-1;;/b;5-3-; |
| InChIKey | XFKHGNAJVUBVSY-FMFSYIAASA-N |
| XLogP | 11.67 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.03 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|