C37H43F3IrNO2- — CID 153484584
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(2,2-dimethylpropyl)-5,7-dimethylquinoline;iridium;(Z)-6,6,6-trifluoro-5-hydroxy-2-methylhex-4-en-3-one (PubChem CID 153484584) has the molecular formula C37H43F3IrNO2- and a molecular weight of 782.97 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(2,2-dimethylpropyl)-5,7-dimethylquinoline;iridium;(Z)-6,6,6-trifluoro-5-hydroxy-2-methylhex-4-en-3-one.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(2,2-dimethylpropyl)-5,7-dimethylquinoline;iridium;(Z)-6,6,6-trifluoro-5-hydroxy-2-methylhex-4-en-3-one |
|---|---|
| PubChem CID | 153484584 |
| Molecular Formula | C37H43F3IrNO2- |
| Molecular Weight | 782.97 g/mol |
| Exact Mass | 783.29 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(2,2-dimethylpropyl)-5,7-dimethylquinoline;iridium;(Z)-6,6,6-trifluoro-5-hydroxy-2-methylhex-4-en-3-one |
| SMILES | CC(C)C(=O)/C=C(\O)C(F)(F)F.Cc1cc(C)c2c(CC(C)(C)C)cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nc2c1.[Ir] |
| InChI | InChI=1S/C30H34N.C7H9F3O2.Ir/c1-19-13-20(2)28-23(18-29(3,4)5)17-26(31-27(28)14-19)22-15-21-11-9-10-12-24(21)25(16-22)30(6,7)8;1-4(2)5(11)3-6(12)7(8,9)10;/h9-14,16-17H,18H2,1-8H3;3-4,12H,1-2H3;/q-1;;/b;6-3-; |
| InChIKey | WUQJLHBLJRKUGC-BIADBTJSSA-N |
| XLogP | 10.57 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.97 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|