C16H28N3O3S+ — CID 153484864
7-[(2,3-dimethyl-2H-imidazol-3-ium-4-yl)sulfonyl]-2-propan-2-yl-7-azaspiro[3.5]nonan-3-ol (PubChem CID 153484864) has the molecular formula C16H28N3O3S+ and a molecular weight of 342.49 g/mol. Its IUPAC name is 7-[(2,3-dimethyl-2H-imidazol-3-ium-4-yl)sulfonyl]-2-propan-2-yl-7-azaspiro[3.5]nonan-3-ol.
| Compound Name | 7-[(2,3-dimethyl-2H-imidazol-3-ium-4-yl)sulfonyl]-2-propan-2-yl-7-azaspiro[3.5]nonan-3-ol |
|---|---|
| PubChem CID | 153484864 |
| Molecular Formula | C16H28N3O3S+ |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 7-[(2,3-dimethyl-2H-imidazol-3-ium-4-yl)sulfonyl]-2-propan-2-yl-7-azaspiro[3.5]nonan-3-ol |
| SMILES | CC(C)C1CC2(CCN(S(=O)(=O)C3=[N+](C)C(C)N=C3)CC2)C1O |
| InChI | InChI=1S/C16H28N3O3S/c1-11(2)13-9-16(15(13)20)5-7-19(8-6-16)23(21,22)14-10-17-12(3)18(14)4/h10-13,15,20H,5-9H2,1-4H3/q+1 |
| InChIKey | DALSUKDJRLKGJU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|