C29H21IrN3O-2 — CID 153485042
iridium;2-phenyl-5-(trideuteriomethyl)pyridine;6-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[3,2-b]pyridin-7-ide (PubChem CID 153485042) has the molecular formula C29H21IrN3O-2 and a molecular weight of 625.76 g/mol. Its IUPAC name is iridium;2-phenyl-5-(trideuteriomethyl)pyridine;6-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[3,2-b]pyridin-7-ide.
| Compound Name | iridium;2-phenyl-5-(trideuteriomethyl)pyridine;6-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[3,2-b]pyridin-7-ide |
|---|---|
| PubChem CID | 153485042 |
| Molecular Formula | C29H21IrN3O-2 |
| Molecular Weight | 625.76 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | iridium;2-phenyl-5-(trideuteriomethyl)pyridine;6-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[3,2-b]pyridin-7-ide |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc2oc3c(-c4ccccn4)[c-]ccc3c2n1.[Ir] |
| InChI | InChI=1S/C17H11N2O.C12H10N.Ir/c1-11-8-9-15-16(19-11)13-6-4-5-12(17(13)20-15)14-7-2-3-10-18-14;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-4,6-10H,1H3;2-5,7-9H,1H3;/q2*-1;/i2*1D3; |
| InChIKey | QFSMOJXUOZGCGL-CKFJQVKPSA-N |
| XLogP | 7.01 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|