C27H26N4O2 — CID 153485432
(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-4-propan-2-yloxy-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153485432) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-4-propan-2-yloxy-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-4-propan-2-yloxy-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485432 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-4-propan-2-yloxy-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4ccnc5ccccc45)nc(OC(C)C)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C27H26N4O2/c1-15(2)33-26-19-10-11-20-16(3)23(32)22(28-5)14-27(20,4)24(19)30-25(31-26)18-12-13-29-21-9-7-6-8-17(18)21/h6-9,12-16,20H,10-11H2,1-4H3/t16-,20-,27-/m1/s1 |
| InChIKey | OJZSOCOGCFQFKA-PJIRNLIGSA-N |
| XLogP | 5.32 |
| TPSA | 69.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|