C28H22FN5O — CID 153485482
(6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-pyrazolo[1,5-a]pyridin-3-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153485482) has the molecular formula C28H22FN5O and a molecular weight of 463.52 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-pyrazolo[1,5-a]pyridin-3-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-pyrazolo[1,5-a]pyridin-3-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485482 |
| Molecular Formula | C28H22FN5O |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-pyrazolo[1,5-a]pyridin-3-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4cnn5ccccc45)nc(-c4ccccc4F)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C28H22FN5O/c1-16-20-12-11-18-24(17-8-4-5-9-21(17)29)32-27(19-15-31-34-13-7-6-10-23(19)34)33-26(18)28(20,2)14-22(30-3)25(16)35/h4-10,13-16,20H,11-12H2,1-2H3/t16-,20-,28-/m1/s1 |
| InChIKey | AHGWDAZPIYUOEK-FYOXXRTDSA-N |
| XLogP | 5.44 |
| TPSA | 64.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|