C21H19FN4O2 — CID 153485607
(6aR,7R,10aS)-2-(2-fluoro-4-pyridinyl)-9-isocyano-4-methoxy-7,10a-dimethyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153485607) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is (6aR,7R,10aS)-2-(2-fluoro-4-pyridinyl)-9-isocyano-4-methoxy-7,10a-dimethyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-2-(2-fluoro-4-pyridinyl)-9-isocyano-4-methoxy-7,10a-dimethyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485607 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (6aR,7R,10aS)-2-(2-fluoro-4-pyridinyl)-9-isocyano-4-methoxy-7,10a-dimethyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4ccnc(F)c4)nc(OC)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C21H19FN4O2/c1-11-14-6-5-13-18(21(14,2)10-15(23-3)17(11)27)25-19(26-20(13)28-4)12-7-8-24-16(22)9-12/h7-11,14H,5-6H2,1-2,4H3/t11-,14-,21-/m1/s1 |
| InChIKey | QFDTVFQQVWSPIZ-HQHPYACNSA-N |
| XLogP | 3.53 |
| TPSA | 69.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|