C19H26BrClO2Si — CID 153487283
(5-bromo-2-chlorophenyl)-[4-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-dien-1-yl]methanol (PubChem CID 153487283) has the molecular formula C19H26BrClO2Si and a molecular weight of 429.86 g/mol. Its IUPAC name is (5-bromo-2-chlorophenyl)-[4-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | (5-bromo-2-chlorophenyl)-[4-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 153487283 |
| Molecular Formula | C19H26BrClO2Si |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | (5-bromo-2-chlorophenyl)-[4-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-dien-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CCC(C(O)c2cc(Br)ccc2Cl)C=C1 |
| InChI | InChI=1S/C19H26BrClO2Si/c1-19(2,3)24(4,5)23-15-9-6-13(7-10-15)18(22)16-12-14(20)8-11-17(16)21/h6,8-13,18,22H,7H2,1-5H3 |
| InChIKey | GCTCZTCDJQWVJU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|