C11H4F6O3 — CID 153487775
5-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-benzofuran-1,3-dione (PubChem CID 153487775) has the molecular formula C11H4F6O3 and a molecular weight of 298.14 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-benzofuran-1,3-dione.
| Compound Name | 5-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 153487775 |
| Molecular Formula | C11H4F6O3 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 5-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C(F)(C(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H4F6O3/c12-9(13)10(14,11(15,16)17)4-1-2-5-6(3-4)8(19)20-7(5)18/h1-3,9H |
| InChIKey | CKXPPGLPVIPRFF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|