C20H14N3O2- — CID 153488462
6-[(4-pyrazol-1-ylphenyl)methyl]quinoline-8-carboxylate (PubChem CID 153488462) has the molecular formula C20H14N3O2- and a molecular weight of 328.35 g/mol. Its IUPAC name is 6-[(4-pyrazol-1-ylphenyl)methyl]quinoline-8-carboxylate.
| Compound Name | 6-[(4-pyrazol-1-ylphenyl)methyl]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 153488462 |
| Molecular Formula | C20H14N3O2- |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 6-[(4-pyrazol-1-ylphenyl)methyl]quinoline-8-carboxylate |
| SMILES | O=C([O-])c1cc(Cc2ccc(-n3cccn3)cc2)cc2cccnc12 |
| InChI | InChI=1S/C20H15N3O2/c24-20(25)18-13-15(12-16-3-1-8-21-19(16)18)11-14-4-6-17(7-5-14)23-10-2-9-22-23/h1-10,12-13H,11H2,(H,24,25)/p-1 |
| InChIKey | XMETXEMVUNOKDP-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |