About (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate
(2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate (PubChem CID 153492498) has the molecular formula C18H25Cl3FNO4Si
and a molecular weight of 472.84 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate.
Molecular Properties
| Compound Name | (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate |
| PubChem CID | 153492498 |
| Molecular Formula | C18H25Cl3FNO4Si |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate |
| SMILES | O=C(OCc1ccccc1[N+](=O)[O-])C(F)CCCCCCCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C18H25Cl3FNO4Si/c19-28(20,21)13-9-5-3-1-2-4-6-11-16(22)18(24)27-14-15-10-7-8-12-17(15)23(25)26/h7-8,10,12,16H,1-6,9,11,13-14H2 |
| InChIKey | CXBYDPZCSTZSBA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate?
The IUPAC name of (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate (CID 153492498) is (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate.
What is the SMILES notation for (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate?
The canonical SMILES for (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate is O=C(OCc1ccccc1[N+](=O)[O-])C(F)CCCCCCCCC[Si](Cl)(Cl)Cl.
What is the InChIKey of (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate?
The InChIKey is CXBYDPZCSTZSBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25Cl3FNO4Si/c19-28(20,21)13-9-5-3-1-2-4-6-11-16(22)18(24)27-14-15-10-7-8-12-17(15)23(25)26/h7-8,10,12,16H,1-6,9,11,13-14H2.
What are the key properties of (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate?
(2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate has a molecular weight of 472.84 g/mol, XLogP of 6.75, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)methyl 2-fluoro-11-trichlorosilylundecanoate is sourced from PubChem (CID 153492498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).