C21H19N4OPt+ — CID 153492589
1,4-dimethyl-2-[3-[3-(1-methylimidazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-2H-imidazol-1-ium;platinum(2+) (PubChem CID 153492589) has the molecular formula C21H19N4OPt+ and a molecular weight of 538.49 g/mol. Its IUPAC name is 1,4-dimethyl-2-[3-[3-(1-methylimidazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-2H-imidazol-1-ium;platinum(2+).
| Compound Name | 1,4-dimethyl-2-[3-[3-(1-methylimidazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-2H-imidazol-1-ium;platinum(2+) |
|---|---|
| PubChem CID | 153492589 |
| Molecular Formula | C21H19N4OPt+ |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 1,4-dimethyl-2-[3-[3-(1-methylimidazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-2H-imidazol-1-ium;platinum(2+) |
| SMILES | CC1=NC(c2[c-]c(Oc3[c-]c(-c4nccn4C)ccc3)ccc2)[N+](C)=C1.[Pt+2] |
| InChI | InChI=1S/C21H19N4O.Pt/c1-15-14-25(3)21(23-15)17-7-5-9-19(13-17)26-18-8-4-6-16(12-18)20-22-10-11-24(20)2;/h4-11,14,21H,1-3H3;/q-1;+2 |
| InChIKey | XGIJQIPBKXJGNK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|