C20H15N5OPt-2 — CID 162492147
CID 162492147 (PubChem CID 162492147) has the molecular formula C20H15N5OPt-2 and a molecular weight of 536.45 g/mol.
| Compound Name | CID 162492147 |
|---|---|
| PubChem CID | 162492147 |
| Molecular Formula | C20H15N5OPt-2 |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | — |
| SMILES | C[n+]1[c-]n(-c2[c-]c(Oc3[c-]c4c(cc3)CCn3ccnc3-4)ccc2)nc1.[Pt] |
| InChI | InChI=1S/C20H15N5O.Pt/c1-23-13-22-25(14-23)16-3-2-4-17(11-16)26-18-6-5-15-7-9-24-10-8-21-20(24)19(15)12-18;/h2-6,8,10,13H,7,9H2,1H3;/q-2; |
| InChIKey | JVZITJPBCGZFPZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|