C28H16IrN4O4S-2 — CID 153493072
iridium;6-nitro-3-(4-nitrobenzene-6-id-1-yl)-1,2-benzothiazole;1-phenylisoquinoline (PubChem CID 153493072) has the molecular formula C28H16IrN4O4S-2 and a molecular weight of 696.74 g/mol. Its IUPAC name is iridium;6-nitro-3-(4-nitrobenzene-6-id-1-yl)-1,2-benzothiazole;1-phenylisoquinoline.
| Compound Name | iridium;6-nitro-3-(4-nitrobenzene-6-id-1-yl)-1,2-benzothiazole;1-phenylisoquinoline |
|---|---|
| PubChem CID | 153493072 |
| Molecular Formula | C28H16IrN4O4S-2 |
| Molecular Weight | 696.74 g/mol |
| Exact Mass | 697.05 |
| IUPAC Name | iridium;6-nitro-3-(4-nitrobenzene-6-id-1-yl)-1,2-benzothiazole;1-phenylisoquinoline |
| SMILES | O=[N+]([O-])c1c[c-]c(-c2nsc3cc([N+](=O)[O-])ccc23)cc1.[Ir].[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C15H10N.C13H6N3O4S.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;17-15(18)9-3-1-8(2-4-9)13-11-6-5-10(16(19)20)7-12(11)21-14-13;/h1-7,9-11H;1,3-7H;/q2*-1; |
| InChIKey | KZZKTJAWQIGEDW-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|