C9H7N3O4S2 — CID 1535
5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-amine (PubChem CID 1535) has the molecular formula C9H7N3O4S2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-amine.
| Compound Name | 5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 1535 |
| Molecular Formula | C9H7N3O4S2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C9H7N3O4S2/c10-9-11-5-8(17-9)18(15,16)7-3-1-6(2-4-7)12(13)14/h1-5H,(H2,10,11) |
| InChIKey | GKTKCGAOXFHFTD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|