C10H18F6O6S4 — CID 15352515
[[(E)-4-[dimethyl(trifluoromethylsulfonyloxy)-λ4-sulfanyl]but-2-enyl]-dimethyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 15352515) has the molecular formula C10H18F6O6S4 and a molecular weight of 476.50 g/mol. Its IUPAC name is [[(E)-4-[dimethyl(trifluoromethylsulfonyloxy)-λ4-sulfanyl]but-2-enyl]-dimethyl-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[(E)-4-[dimethyl(trifluoromethylsulfonyloxy)-λ4-sulfanyl]but-2-enyl]-dimethyl-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15352515 |
| Molecular Formula | C10H18F6O6S4 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | [[(E)-4-[dimethyl(trifluoromethylsulfonyloxy)-λ4-sulfanyl]but-2-enyl]-dimethyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CS(C)(C/C=C/CS(C)(C)OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H18F6O6S4/c1-23(2,21-25(17,18)9(11,12)13)7-5-6-8-24(3,4)22-26(19,20)10(14,15)16/h5-6H,7-8H2,1-4H3/b6-5+ |
| InChIKey | AKJBCVDNYFOLIS-AATRIKPKSA-N |
| XLogP | 3.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|