C8H11F7O3S2 — CID 139974933
[dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate (PubChem CID 139974933) has the molecular formula C8H11F7O3S2 and a molecular weight of 352.29 g/mol. Its IUPAC name is [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate.
| Compound Name | [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 139974933 |
| Molecular Formula | C8H11F7O3S2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
| SMILES | C=CCS(C)(C)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F7O3S2/c1-4-5-19(2,3)18-20(16,17)8(14,15)6(9,10)7(11,12)13/h4H,1,5H2,2-3H3 |
| InChIKey | PVMDSAMPNMVITN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|