C10H11F11O3S2 — CID 139975003
[dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate (PubChem CID 139975003) has the molecular formula C10H11F11O3S2 and a molecular weight of 452.31 g/mol. Its IUPAC name is [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate.
| Compound Name | [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 139975003 |
| Molecular Formula | C10H11F11O3S2 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
| SMILES | C=CCS(C)(C)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F11O3S2/c1-4-5-25(2,3)24-26(22,23)10(20,21)8(15,16)6(11,12)7(13,14)9(17,18)19/h4H,1,5H2,2-3H3 |
| InChIKey | RGPFIVWEBSISDM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|